C16H16N4O — CID 123618247
4-(2,5-dimethylphenyl)-6-imino-3-methyl-4,5-dihydro-2H-pyrano[2,3-c]pyrazole-5-carbonitrile (PubChem CID 123618247) has the molecular formula C16H16N4O and a molecular weight of 280.33 g/mol. Its IUPAC name is 4-(2,5-dimethylphenyl)-6-imino-3-methyl-4,5-dihydro-2H-pyrano[2,3-c]pyrazole-5-carbonitrile.
| Compound Name | 4-(2,5-dimethylphenyl)-6-imino-3-methyl-4,5-dihydro-2H-pyrano[2,3-c]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 123618247 |
| Molecular Formula | C16H16N4O |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | 4-(2,5-dimethylphenyl)-6-imino-3-methyl-4,5-dihydro-2H-pyrano[2,3-c]pyrazole-5-carbonitrile |
| SMILES | [H]/N=C1\Oc2n[nH]c(C)c2C(c2cc(C)ccc2C)C1C#N |
| InChI | InChI=1S/C16H16N4O/c1-8-4-5-9(2)11(6-8)14-12(7-17)15(18)21-16-13(14)10(3)19-20-16/h4-6,12,14,18H,1-3H3,(H,19,20)/b18-15- |
| InChIKey | ZYQQQHNUQCEKRQ-SDXDJHTJSA-N |
| XLogP | 2.98 |
| TPSA | 85.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|