C19H16N4O4 — CID 91897939
3-(2,5-dimethoxyphenyl)-4-(furan-2-yl)-6-imino-4,5-dihydro-2H-pyrano[2,3-c]pyrazole-5-carbonitrile (PubChem CID 91897939) has the molecular formula C19H16N4O4 and a molecular weight of 364.36 g/mol. Its IUPAC name is 3-(2,5-dimethoxyphenyl)-4-(furan-2-yl)-6-imino-4,5-dihydro-2H-pyrano[2,3-c]pyrazole-5-carbonitrile.
| Compound Name | 3-(2,5-dimethoxyphenyl)-4-(furan-2-yl)-6-imino-4,5-dihydro-2H-pyrano[2,3-c]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 91897939 |
| Molecular Formula | C19H16N4O4 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 3-(2,5-dimethoxyphenyl)-4-(furan-2-yl)-6-imino-4,5-dihydro-2H-pyrano[2,3-c]pyrazole-5-carbonitrile |
| SMILES | [H]/N=C1\Oc2n[nH]c(-c3cc(OC)ccc3OC)c2C(c2ccco2)C1C#N |
| InChI | InChI=1S/C19H16N4O4/c1-24-10-5-6-13(25-2)11(8-10)17-16-15(14-4-3-7-26-14)12(9-20)18(21)27-19(16)23-22-17/h3-8,12,15,21H,1-2H3,(H,22,23)/b21-18- |
| InChIKey | NDGCNWGDTBIDCS-UZYVYHOESA-N |
| XLogP | 3.33 |
| TPSA | 117.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|