C15H14N4O — CID 123276601
6-imino-3,4-dimethyl-4-phenyl-2,5-dihydropyrano[2,3-c]pyrazole-5-carbonitrile (PubChem CID 123276601) has the molecular formula C15H14N4O and a molecular weight of 266.30 g/mol. Its IUPAC name is 6-imino-3,4-dimethyl-4-phenyl-2,5-dihydropyrano[2,3-c]pyrazole-5-carbonitrile.
| Compound Name | 6-imino-3,4-dimethyl-4-phenyl-2,5-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
|---|---|
| PubChem CID | 123276601 |
| Molecular Formula | C15H14N4O |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 6-imino-3,4-dimethyl-4-phenyl-2,5-dihydropyrano[2,3-c]pyrazole-5-carbonitrile |
| SMILES | [H]/N=C1\Oc2n[nH]c(C)c2C(C)(c2ccccc2)C1C#N |
| InChI | InChI=1S/C15H14N4O/c1-9-12-14(19-18-9)20-13(17)11(8-16)15(12,2)10-6-4-3-5-7-10/h3-7,11,17H,1-2H3,(H,18,19)/b17-13- |
| InChIKey | ZOWMLUYPUMOCSH-LGMDPLHJSA-N |
| XLogP | 2.53 |
| TPSA | 85.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|