C11H10N2 — CID 129148975
5,7-dimethyl-1H-indole-6-carbonitrile (PubChem CID 129148975) has the molecular formula C11H10N2 and a molecular weight of 170.21 g/mol. Its IUPAC name is 5,7-dimethyl-1H-indole-6-carbonitrile.
| Compound Name | 5,7-dimethyl-1H-indole-6-carbonitrile |
|---|---|
| PubChem CID | 129148975 |
| Molecular Formula | C11H10N2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 5,7-dimethyl-1H-indole-6-carbonitrile |
| SMILES | Cc1cc2cc[nH]c2c(C)c1C#N |
| InChI | InChI=1S/C11H10N2/c1-7-5-9-3-4-13-11(9)8(2)10(7)6-12/h3-5,13H,1-2H3 |
| InChIKey | IXDCCSXGFDGRQP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 39.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |