C9H4F2N2 — CID 118989891
6,7-difluoro-1H-indole-5-carbonitrile (PubChem CID 118989891) has the molecular formula C9H4F2N2 and a molecular weight of 178.14 g/mol. Its IUPAC name is 6,7-difluoro-1H-indole-5-carbonitrile.
| Compound Name | 6,7-difluoro-1H-indole-5-carbonitrile |
|---|---|
| PubChem CID | 118989891 |
| Molecular Formula | C9H4F2N2 |
| Molecular Weight | 178.14 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | 6,7-difluoro-1H-indole-5-carbonitrile |
| SMILES | N#Cc1cc2cc[nH]c2c(F)c1F |
| InChI | InChI=1S/C9H4F2N2/c10-7-6(4-12)3-5-1-2-13-9(5)8(7)11/h1-3,13H |
| InChIKey | JQZPRMWRTSRJEA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 39.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.14 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |