C15H6F4N2O — CID 167505529
2-fluoro-5-[(4,6,7-trifluoro-1H-indol-5-yl)oxy]benzonitrile (PubChem CID 167505529) has the molecular formula C15H6F4N2O and a molecular weight of 306.22 g/mol. Its IUPAC name is 2-fluoro-5-[(4,6,7-trifluoro-1H-indol-5-yl)oxy]benzonitrile.
| Compound Name | 2-fluoro-5-[(4,6,7-trifluoro-1H-indol-5-yl)oxy]benzonitrile |
|---|---|
| PubChem CID | 167505529 |
| Molecular Formula | C15H6F4N2O |
| Molecular Weight | 306.22 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 2-fluoro-5-[(4,6,7-trifluoro-1H-indol-5-yl)oxy]benzonitrile |
| SMILES | N#Cc1cc(Oc2c(F)c(F)c3[nH]ccc3c2F)ccc1F |
| InChI | InChI=1S/C15H6F4N2O/c16-10-2-1-8(5-7(10)6-20)22-15-11(17)9-3-4-21-14(9)12(18)13(15)19/h1-5,21H |
| InChIKey | YAMZOZPUNZIDCQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 48.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.22 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|