C25H22F2N2O4 — CID 171079141
tert-butyl 3-[3-[5-(3-cyano-4-fluorophenoxy)-6-fluoro-1H-indol-4-yl]prop-2-ynoxy]propanoate (PubChem CID 171079141) has the molecular formula C25H22F2N2O4 and a molecular weight of 452.46 g/mol. Its IUPAC name is tert-butyl 3-[3-[5-(3-cyano-4-fluorophenoxy)-6-fluoro-1H-indol-4-yl]prop-2-ynoxy]propanoate.
| Compound Name | tert-butyl 3-[3-[5-(3-cyano-4-fluorophenoxy)-6-fluoro-1H-indol-4-yl]prop-2-ynoxy]propanoate |
|---|---|
| PubChem CID | 171079141 |
| Molecular Formula | C25H22F2N2O4 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | tert-butyl 3-[3-[5-(3-cyano-4-fluorophenoxy)-6-fluoro-1H-indol-4-yl]prop-2-ynoxy]propanoate |
| SMILES | CC(C)(C)OC(=O)CCOCC#Cc1c(Oc2ccc(F)c(C#N)c2)c(F)cc2[nH]ccc12 |
| InChI | InChI=1S/C25H22F2N2O4/c1-25(2,3)33-23(30)9-12-31-11-4-5-19-18-8-10-29-22(18)14-21(27)24(19)32-17-6-7-20(26)16(13-17)15-28/h6-8,10,13-14,29H,9,11-12H2,1-3H3 |
| InChIKey | VZMZBLTXQKMGNE-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|