C18H12F2N2O — CID 171078040
2-fluoro-5-[(6-fluoro-4-prop-2-enyl-1H-indol-5-yl)oxy]benzonitrile (PubChem CID 171078040) has the molecular formula C18H12F2N2O and a molecular weight of 310.30 g/mol. Its IUPAC name is 2-fluoro-5-[(6-fluoro-4-prop-2-enyl-1H-indol-5-yl)oxy]benzonitrile.
| Compound Name | 2-fluoro-5-[(6-fluoro-4-prop-2-enyl-1H-indol-5-yl)oxy]benzonitrile |
|---|---|
| PubChem CID | 171078040 |
| Molecular Formula | C18H12F2N2O |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 2-fluoro-5-[(6-fluoro-4-prop-2-enyl-1H-indol-5-yl)oxy]benzonitrile |
| SMILES | C=CCc1c(Oc2ccc(F)c(C#N)c2)c(F)cc2[nH]ccc12 |
| InChI | InChI=1S/C18H12F2N2O/c1-2-3-14-13-6-7-22-17(13)9-16(20)18(14)23-12-4-5-15(19)11(8-12)10-21/h2,4-9,22H,1,3H2 |
| InChIKey | NPKSRDIPMATCMC-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 48.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|