C17H13F4N3O — CID 167504472
5-[[4-(2,2-difluoroethyl)-6-fluoro-1H-indol-5-yl]oxy]-2-fluorobenzenecarboximidamide (PubChem CID 167504472) has the molecular formula C17H13F4N3O and a molecular weight of 351.30 g/mol. Its IUPAC name is 5-[[4-(2,2-difluoroethyl)-6-fluoro-1H-indol-5-yl]oxy]-2-fluorobenzenecarboximidamide.
| Compound Name | 5-[[4-(2,2-difluoroethyl)-6-fluoro-1H-indol-5-yl]oxy]-2-fluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 167504472 |
| Molecular Formula | C17H13F4N3O |
| Molecular Weight | 351.30 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 5-[[4-(2,2-difluoroethyl)-6-fluoro-1H-indol-5-yl]oxy]-2-fluorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(Oc2c(F)cc3[nH]ccc3c2CC(F)F)ccc1F |
| InChI | InChI=1S/C17H13F4N3O/c18-12-2-1-8(5-11(12)17(22)23)25-16-10(6-15(20)21)9-3-4-24-14(9)7-13(16)19/h1-5,7,15,24H,6H2,(H3,22,23) |
| InChIKey | LRLVQIPOQJYZCZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 74.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.30 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|