C21H12ClF2N3O — CID 176852395
4-[(5-chloro-2-pyridinyl)methyl]-6-fluoro-5-(4-fluoro-3-isocyanophenoxy)-1H-indole (PubChem CID 176852395) has the molecular formula C21H12ClF2N3O and a molecular weight of 395.80 g/mol. Its IUPAC name is 4-[(5-chloro-2-pyridinyl)methyl]-6-fluoro-5-(4-fluoro-3-isocyanophenoxy)-1H-indole.
| Compound Name | 4-[(5-chloro-2-pyridinyl)methyl]-6-fluoro-5-(4-fluoro-3-isocyanophenoxy)-1H-indole |
|---|---|
| PubChem CID | 176852395 |
| Molecular Formula | C21H12ClF2N3O |
| Molecular Weight | 395.80 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 4-[(5-chloro-2-pyridinyl)methyl]-6-fluoro-5-(4-fluoro-3-isocyanophenoxy)-1H-indole |
| SMILES | [C-]#[N+]c1cc(Oc2c(F)cc3[nH]ccc3c2Cc2ccc(Cl)cn2)ccc1F |
| InChI | InChI=1S/C21H12ClF2N3O/c1-25-20-9-14(4-5-17(20)23)28-21-16(8-13-3-2-12(22)11-27-13)15-6-7-26-19(15)10-18(21)24/h2-7,9-11,26H,8H2 |
| InChIKey | YMLRDQMRJSRPDH-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 42.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.80 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|