C16H12F2N6O — CID 171076713
5-[[4-(azidomethyl)-6-fluoro-1H-indol-5-yl]oxy]-2-fluorobenzenecarboximidamide (PubChem CID 171076713) has the molecular formula C16H12F2N6O and a molecular weight of 342.31 g/mol. Its IUPAC name is 5-[[4-(azidomethyl)-6-fluoro-1H-indol-5-yl]oxy]-2-fluorobenzenecarboximidamide.
| Compound Name | 5-[[4-(azidomethyl)-6-fluoro-1H-indol-5-yl]oxy]-2-fluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 171076713 |
| Molecular Formula | C16H12F2N6O |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | 5-[[4-(azidomethyl)-6-fluoro-1H-indol-5-yl]oxy]-2-fluorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(Oc2c(F)cc3[nH]ccc3c2CN=[N+]=[N-])ccc1F |
| InChI | InChI=1S/C16H12F2N6O/c17-12-2-1-8(5-10(12)16(19)20)25-15-11(7-23-24-21)9-3-4-22-14(9)6-13(15)18/h1-6,22H,7H2,(H3,19,20) |
| InChIKey | LLFHYNMVDYYOKJ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 123.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|