C18H13FN4OS — CID 167504756
3-[[6-fluoro-4-(1,3-thiazol-2-yl)-1H-indol-5-yl]oxy]benzenecarboximidamide (PubChem CID 167504756) has the molecular formula C18H13FN4OS and a molecular weight of 352.39 g/mol. Its IUPAC name is 3-[[6-fluoro-4-(1,3-thiazol-2-yl)-1H-indol-5-yl]oxy]benzenecarboximidamide.
| Compound Name | 3-[[6-fluoro-4-(1,3-thiazol-2-yl)-1H-indol-5-yl]oxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 167504756 |
| Molecular Formula | C18H13FN4OS |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 3-[[6-fluoro-4-(1,3-thiazol-2-yl)-1H-indol-5-yl]oxy]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(Oc2c(F)cc3[nH]ccc3c2-c2nccs2)c1 |
| InChI | InChI=1S/C18H13FN4OS/c19-13-9-14-12(4-5-22-14)15(18-23-6-7-25-18)16(13)24-11-3-1-2-10(8-11)17(20)21/h1-9,22H,(H3,20,21) |
| InChIKey | NNHQPAMGVFOHMZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|