C17H13FN2OS — CID 171077473
3-[(4-ethenyl-6-fluoro-1H-indol-5-yl)oxy]benzenecarbothioamide (PubChem CID 171077473) has the molecular formula C17H13FN2OS and a molecular weight of 312.37 g/mol. Its IUPAC name is 3-[(4-ethenyl-6-fluoro-1H-indol-5-yl)oxy]benzenecarbothioamide.
| Compound Name | 3-[(4-ethenyl-6-fluoro-1H-indol-5-yl)oxy]benzenecarbothioamide |
|---|---|
| PubChem CID | 171077473 |
| Molecular Formula | C17H13FN2OS |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 3-[(4-ethenyl-6-fluoro-1H-indol-5-yl)oxy]benzenecarbothioamide |
| SMILES | C=Cc1c(Oc2cccc(C(N)=S)c2)c(F)cc2[nH]ccc12 |
| InChI | InChI=1S/C17H13FN2OS/c1-2-12-13-6-7-20-15(13)9-14(18)16(12)21-11-5-3-4-10(8-11)17(19)22/h2-9,20H,1H2,(H2,19,22) |
| InChIKey | QMAZORFCCWXIMC-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 51.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|