C19H17F2N3O2 — CID 167504458
5-[[4-(2-ethoxyethenyl)-6-fluoro-1H-indol-5-yl]oxy]-2-fluorobenzenecarboximidamide (PubChem CID 167504458) has the molecular formula C19H17F2N3O2 and a molecular weight of 357.36 g/mol. Its IUPAC name is 5-[[4-(2-ethoxyethenyl)-6-fluoro-1H-indol-5-yl]oxy]-2-fluorobenzenecarboximidamide.
| Compound Name | 5-[[4-(2-ethoxyethenyl)-6-fluoro-1H-indol-5-yl]oxy]-2-fluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 167504458 |
| Molecular Formula | C19H17F2N3O2 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 5-[[4-(2-ethoxyethenyl)-6-fluoro-1H-indol-5-yl]oxy]-2-fluorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(Oc2c(F)cc3[nH]ccc3c2C=COCC)ccc1F |
| InChI | InChI=1S/C19H17F2N3O2/c1-2-25-8-6-13-12-5-7-24-17(12)10-16(21)18(13)26-11-3-4-15(20)14(9-11)19(22)23/h3-10,24H,2H2,1H3,(H3,22,23) |
| InChIKey | SJSVWRZBPXWLKW-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 84.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|