C19H18FN3O3S — CID 171078591
ethyl 2-[6-fluoro-5-[[2-(C-methylsulfanylcarbonimidoyl)-4-pyridinyl]oxy]-1H-indol-4-yl]acetate (PubChem CID 171078591) has the molecular formula C19H18FN3O3S and a molecular weight of 387.44 g/mol. Its IUPAC name is ethyl 2-[6-fluoro-5-[[2-(C-methylsulfanylcarbonimidoyl)-4-pyridinyl]oxy]-1H-indol-4-yl]acetate.
| Compound Name | ethyl 2-[6-fluoro-5-[[2-(C-methylsulfanylcarbonimidoyl)-4-pyridinyl]oxy]-1H-indol-4-yl]acetate |
|---|---|
| PubChem CID | 171078591 |
| Molecular Formula | C19H18FN3O3S |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | ethyl 2-[6-fluoro-5-[[2-(C-methylsulfanylcarbonimidoyl)-4-pyridinyl]oxy]-1H-indol-4-yl]acetate |
| SMILES | [H]/N=C(\SC)c1cc(Oc2c(F)cc3[nH]ccc3c2CC(=O)OCC)ccn1 |
| InChI | InChI=1S/C19H18FN3O3S/c1-3-25-17(24)9-13-12-5-7-22-15(12)10-14(20)18(13)26-11-4-6-23-16(8-11)19(21)27-2/h4-8,10,21-22H,3,9H2,1-2H3/b21-19- |
| InChIKey | SYDCUOARPNYAGF-VZCXRCSSSA-N |
| XLogP | 4.29 |
| TPSA | 88.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|