C11H10F3NO — CID 167505603
4-(2,2-difluoroethyl)-6-fluoro-5-methoxy-1H-indole (PubChem CID 167505603) has the molecular formula C11H10F3NO and a molecular weight of 229.20 g/mol. Its IUPAC name is 4-(2,2-difluoroethyl)-6-fluoro-5-methoxy-1H-indole.
| Compound Name | 4-(2,2-difluoroethyl)-6-fluoro-5-methoxy-1H-indole |
|---|---|
| PubChem CID | 167505603 |
| Molecular Formula | C11H10F3NO |
| Molecular Weight | 229.20 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 4-(2,2-difluoroethyl)-6-fluoro-5-methoxy-1H-indole |
| SMILES | COc1c(F)cc2[nH]ccc2c1CC(F)F |
| InChI | InChI=1S/C11H10F3NO/c1-16-11-7(4-10(13)14)6-2-3-15-9(6)5-8(11)12/h2-3,5,10,15H,4H2,1H3 |
| InChIKey | OWFXIPFGUZBHTG-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.20 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |