C9H5F2NO2 — CID 117274550
5,7-difluoro-1H-indole-6-carboxylic acid (PubChem CID 117274550) has the molecular formula C9H5F2NO2 and a molecular weight of 197.14 g/mol. Its IUPAC name is 5,7-difluoro-1H-indole-6-carboxylic acid.
| Compound Name | 5,7-difluoro-1H-indole-6-carboxylic acid |
|---|---|
| PubChem CID | 117274550 |
| Molecular Formula | C9H5F2NO2 |
| Molecular Weight | 197.14 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | 5,7-difluoro-1H-indole-6-carboxylic acid |
| SMILES | O=C(O)c1c(F)cc2cc[nH]c2c1F |
| InChI | InChI=1S/C9H5F2NO2/c10-5-3-4-1-2-12-8(4)7(11)6(5)9(13)14/h1-3,12H,(H,13,14) |
| InChIKey | KLEDKGAMDAVCDS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.14 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |