About 1-(5,7-difluoro-1H-indol-6-yl)cyclopentan-1-amine
1-(5,7-difluoro-1H-indol-6-yl)cyclopentan-1-amine (PubChem CID 117344483) has the molecular formula C13H14F2N2
and a molecular weight of 236.26 g/mol. Its IUPAC name is 1-(5,7-difluoro-1H-indol-6-yl)cyclopentan-1-amine.
Molecular Properties
| Compound Name | 1-(5,7-difluoro-1H-indol-6-yl)cyclopentan-1-amine |
| PubChem CID | 117344483 |
| Molecular Formula | C13H14F2N2 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 1-(5,7-difluoro-1H-indol-6-yl)cyclopentan-1-amine |
| SMILES | NC1(c2c(F)cc3cc[nH]c3c2F)CCCC1 |
| InChI | InChI=1S/C13H14F2N2/c14-9-7-8-3-6-17-12(8)11(15)10(9)13(16)4-1-2-5-13/h3,6-7,17H,1-2,4-5,16H2 |
| InChIKey | VRXVUGFLZQZXDJ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(5,7-difluoro-1H-indol-6-yl)cyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5,7-difluoro-1H-indol-6-yl)cyclopentan-1-amine?
The IUPAC name of 1-(5,7-difluoro-1H-indol-6-yl)cyclopentan-1-amine (CID 117344483) is 1-(5,7-difluoro-1H-indol-6-yl)cyclopentan-1-amine.
What is the SMILES notation for 1-(5,7-difluoro-1H-indol-6-yl)cyclopentan-1-amine?
The canonical SMILES for 1-(5,7-difluoro-1H-indol-6-yl)cyclopentan-1-amine is NC1(c2c(F)cc3cc[nH]c3c2F)CCCC1.
What is the InChIKey of 1-(5,7-difluoro-1H-indol-6-yl)cyclopentan-1-amine?
The InChIKey is VRXVUGFLZQZXDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F2N2/c14-9-7-8-3-6-17-12(8)11(15)10(9)13(16)4-1-2-5-13/h3,6-7,17H,1-2,4-5,16H2.
What are the key properties of 1-(5,7-difluoro-1H-indol-6-yl)cyclopentan-1-amine?
1-(5,7-difluoro-1H-indol-6-yl)cyclopentan-1-amine has a molecular weight of 236.26 g/mol, XLogP of 3.17, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5,7-difluoro-1H-indol-6-yl)cyclopentan-1-amine is sourced from PubChem (CID 117344483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).