C11H13ClF3N — CID 117046880
1-(2,4,6-trifluorophenyl)cyclopentan-1-amine;hydrochloride (PubChem CID 117046880) has the molecular formula C11H13ClF3N and a molecular weight of 251.68 g/mol. Its IUPAC name is 1-(2,4,6-trifluorophenyl)cyclopentan-1-amine;hydrochloride.
| Compound Name | 1-(2,4,6-trifluorophenyl)cyclopentan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 117046880 |
| Molecular Formula | C11H13ClF3N |
| Molecular Weight | 251.68 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 1-(2,4,6-trifluorophenyl)cyclopentan-1-amine;hydrochloride |
| SMILES | Cl.NC1(c2c(F)cc(F)cc2F)CCCC1 |
| InChI | InChI=1S/C11H12F3N.ClH/c12-7-5-8(13)10(9(14)6-7)11(15)3-1-2-4-11;/h5-6H,1-4,15H2;1H |
| InChIKey | GMLNHRNPGVBBSO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.68 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |