C10H4F2N2O — CID 165460779
7,8-difluoro-2-oxo-1H-quinoline-3-carbonitrile (PubChem CID 165460779) has the molecular formula C10H4F2N2O and a molecular weight of 206.15 g/mol. Its IUPAC name is 7,8-difluoro-2-oxo-1H-quinoline-3-carbonitrile.
| Compound Name | 7,8-difluoro-2-oxo-1H-quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 165460779 |
| Molecular Formula | C10H4F2N2O |
| Molecular Weight | 206.15 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | 7,8-difluoro-2-oxo-1H-quinoline-3-carbonitrile |
| SMILES | N#Cc1cc2ccc(F)c(F)c2[nH]c1=O |
| InChI | InChI=1S/C10H4F2N2O/c11-7-2-1-5-3-6(4-13)10(15)14-9(5)8(7)12/h1-3H,(H,14,15) |
| InChIKey | HSCHANBZPYFFIZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.15 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |