C15H9N3O — CID 131842504
2-oxo-7-phenyl-1H-1,8-naphthyridine-3-carbonitrile (PubChem CID 131842504) has the molecular formula C15H9N3O and a molecular weight of 247.26 g/mol. Its IUPAC name is 2-oxo-7-phenyl-1H-1,8-naphthyridine-3-carbonitrile.
| Compound Name | 2-oxo-7-phenyl-1H-1,8-naphthyridine-3-carbonitrile |
|---|---|
| PubChem CID | 131842504 |
| Molecular Formula | C15H9N3O |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 2-oxo-7-phenyl-1H-1,8-naphthyridine-3-carbonitrile |
| SMILES | N#Cc1cc2ccc(-c3ccccc3)nc2[nH]c1=O |
| InChI | InChI=1S/C15H9N3O/c16-9-12-8-11-6-7-13(10-4-2-1-3-5-10)17-14(11)18-15(12)19/h1-8H,(H,17,18,19) |
| InChIKey | WQZSJOAPPRQHJM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |