About 2-oxo-1H-quinoline-3-carbonitrile;tribromoborane
2-oxo-1H-quinoline-3-carbonitrile;tribromoborane (PubChem CID 175799807) has the molecular formula C10H6BBr3N2O
and a molecular weight of 420.70 g/mol. Its IUPAC name is 2-oxo-1H-quinoline-3-carbonitrile;tribromoborane.
Molecular Properties
| Compound Name | 2-oxo-1H-quinoline-3-carbonitrile;tribromoborane |
| PubChem CID | 175799807 |
| Molecular Formula | C10H6BBr3N2O |
| Molecular Weight | 420.70 g/mol |
| Exact Mass | 417.81 |
| IUPAC Name | 2-oxo-1H-quinoline-3-carbonitrile;tribromoborane |
| SMILES | BrB(Br)Br.N#Cc1cc2ccccc2[nH]c1=O |
| InChI | InChI=1S/C10H6N2O.BBr3/c11-6-8-5-7-3-1-2-4-9(7)12-10(8)13;2-1(3)4/h1-5H,(H,12,13); |
| InChIKey | VCBNPHVBUJNZEX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 420.70 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-oxo-1H-quinoline-3-carbonitrile;tribromoborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-1H-quinoline-3-carbonitrile;tribromoborane?
The IUPAC name of 2-oxo-1H-quinoline-3-carbonitrile;tribromoborane (CID 175799807) is 2-oxo-1H-quinoline-3-carbonitrile;tribromoborane.
What is the SMILES notation for 2-oxo-1H-quinoline-3-carbonitrile;tribromoborane?
The canonical SMILES for 2-oxo-1H-quinoline-3-carbonitrile;tribromoborane is BrB(Br)Br.N#Cc1cc2ccccc2[nH]c1=O.
What is the InChIKey of 2-oxo-1H-quinoline-3-carbonitrile;tribromoborane?
The InChIKey is VCBNPHVBUJNZEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N2O.BBr3/c11-6-8-5-7-3-1-2-4-9(7)12-10(8)13;2-1(3)4/h1-5H,(H,12,13);.
What are the key properties of 2-oxo-1H-quinoline-3-carbonitrile;tribromoborane?
2-oxo-1H-quinoline-3-carbonitrile;tribromoborane has a molecular weight of 420.70 g/mol, XLogP of 3.56, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-1H-quinoline-3-carbonitrile;tribromoborane is sourced from PubChem (CID 175799807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).