C12H11BrN2O2 — CID 142731854
N-(2-bromoethyl)-2-oxo-1H-quinoline-3-carboxamide (PubChem CID 142731854) has the molecular formula C12H11BrN2O2 and a molecular weight of 295.14 g/mol. Its IUPAC name is N-(2-bromoethyl)-2-oxo-1H-quinoline-3-carboxamide.
| Compound Name | N-(2-bromoethyl)-2-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 142731854 |
| Molecular Formula | C12H11BrN2O2 |
| Molecular Weight | 295.14 g/mol |
| Exact Mass | 294.00 |
| IUPAC Name | N-(2-bromoethyl)-2-oxo-1H-quinoline-3-carboxamide |
| SMILES | O=C(NCCBr)c1cc2ccccc2[nH]c1=O |
| InChI | InChI=1S/C12H11BrN2O2/c13-5-6-14-11(16)9-7-8-3-1-2-4-10(8)15-12(9)17/h1-4,7H,5-6H2,(H,14,16)(H,15,17) |
| InChIKey | NYEAEOMRXUHDNF-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.14 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|