C16H14N2O2S — CID 16589972
2-oxo-N-(2-thiophen-2-ylethyl)-1H-quinoline-3-carboxamide (PubChem CID 16589972) has the molecular formula C16H14N2O2S and a molecular weight of 298.37 g/mol. Its IUPAC name is 2-oxo-N-(2-thiophen-2-ylethyl)-1H-quinoline-3-carboxamide.
| Compound Name | 2-oxo-N-(2-thiophen-2-ylethyl)-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 16589972 |
| Molecular Formula | C16H14N2O2S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 2-oxo-N-(2-thiophen-2-ylethyl)-1H-quinoline-3-carboxamide |
| SMILES | O=C(NCCc1cccs1)c1cc2ccccc2[nH]c1=O |
| InChI | InChI=1S/C16H14N2O2S/c19-15(17-8-7-12-5-3-9-21-12)13-10-11-4-1-2-6-14(11)18-16(13)20/h1-6,9-10H,7-8H2,(H,17,19)(H,18,20) |
| InChIKey | GLDTTWQTMLGLRI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |