C11H7N3 — CID 12732461
3,6-dimethylbenzene-1,2,4-tricarbonitrile (PubChem CID 12732461) has the molecular formula C11H7N3 and a molecular weight of 181.20 g/mol. Its IUPAC name is 3,6-dimethylbenzene-1,2,4-tricarbonitrile.
| Compound Name | 3,6-dimethylbenzene-1,2,4-tricarbonitrile |
|---|---|
| PubChem CID | 12732461 |
| Molecular Formula | C11H7N3 |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | 3,6-dimethylbenzene-1,2,4-tricarbonitrile |
| SMILES | Cc1cc(C#N)c(C)c(C#N)c1C#N |
| InChI | InChI=1S/C11H7N3/c1-7-3-9(4-12)8(2)11(6-14)10(7)5-13/h3H,1-2H3 |
| InChIKey | ULTNGFZQRPYOLB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |