C11H11N3O2S — CID 86043274
2,4-dicyano-N,3,6-trimethylbenzenesulfonamide (PubChem CID 86043274) has the molecular formula C11H11N3O2S and a molecular weight of 249.29 g/mol. Its IUPAC name is 2,4-dicyano-N,3,6-trimethylbenzenesulfonamide.
| Compound Name | 2,4-dicyano-N,3,6-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 86043274 |
| Molecular Formula | C11H11N3O2S |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 2,4-dicyano-N,3,6-trimethylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1c(C)cc(C#N)c(C)c1C#N |
| InChI | InChI=1S/C11H11N3O2S/c1-7-4-9(5-12)8(2)10(6-13)11(7)17(15,16)14-3/h4,14H,1-3H3 |
| InChIKey | XBRNKPHFPJSEQF-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 93.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |