C9H10N2O2S — CID 106832880
4-cyano-N,3-dimethylbenzenesulfonamide (PubChem CID 106832880) has the molecular formula C9H10N2O2S and a molecular weight of 210.26 g/mol. Its IUPAC name is 4-cyano-N,3-dimethylbenzenesulfonamide.
| Compound Name | 4-cyano-N,3-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 106832880 |
| Molecular Formula | C9H10N2O2S |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 4-cyano-N,3-dimethylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(C#N)c(C)c1 |
| InChI | InChI=1S/C9H10N2O2S/c1-7-5-9(14(12,13)11-2)4-3-8(7)6-10/h3-5,11H,1-2H3 |
| InChIKey | WIFHUYUTUVWXON-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |