C12H12N2O2S — CID 106833285
N-but-3-ynyl-4-cyano-3-methylbenzenesulfonamide (PubChem CID 106833285) has the molecular formula C12H12N2O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is N-but-3-ynyl-4-cyano-3-methylbenzenesulfonamide.
| Compound Name | N-but-3-ynyl-4-cyano-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 106833285 |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | N-but-3-ynyl-4-cyano-3-methylbenzenesulfonamide |
| SMILES | C#CCCNS(=O)(=O)c1ccc(C#N)c(C)c1 |
| InChI | InChI=1S/C12H12N2O2S/c1-3-4-7-14-17(15,16)12-6-5-11(9-13)10(2)8-12/h1,5-6,8,14H,4,7H2,2H3 |
| InChIKey | XEBGCUVYLNVQPY-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|