C10H14ClN3O2S — CID 120998868
N-(2-aminoethyl)-4-cyano-3-methylbenzenesulfonamide;hydrochloride (PubChem CID 120998868) has the molecular formula C10H14ClN3O2S and a molecular weight of 275.76 g/mol. Its IUPAC name is N-(2-aminoethyl)-4-cyano-3-methylbenzenesulfonamide;hydrochloride.
| Compound Name | N-(2-aminoethyl)-4-cyano-3-methylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120998868 |
| Molecular Formula | C10H14ClN3O2S |
| Molecular Weight | 275.76 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | N-(2-aminoethyl)-4-cyano-3-methylbenzenesulfonamide;hydrochloride |
| SMILES | Cc1cc(S(=O)(=O)NCCN)ccc1C#N.Cl |
| InChI | InChI=1S/C10H13N3O2S.ClH/c1-8-6-10(3-2-9(8)7-12)16(14,15)13-5-4-11;/h2-3,6,13H,4-5,11H2,1H3;1H |
| InChIKey | DGEVDIXVHPKUOK-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.76 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |