C10H5N3 — CID 54234334
3-methylbenzene-1,2,4-tricarbonitrile (PubChem CID 54234334) has the molecular formula C10H5N3 and a molecular weight of 167.17 g/mol. Its IUPAC name is 3-methylbenzene-1,2,4-tricarbonitrile.
| Compound Name | 3-methylbenzene-1,2,4-tricarbonitrile |
|---|---|
| PubChem CID | 54234334 |
| Molecular Formula | C10H5N3 |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | 3-methylbenzene-1,2,4-tricarbonitrile |
| SMILES | Cc1c(C#N)ccc(C#N)c1C#N |
| InChI | InChI=1S/C10H5N3/c1-7-8(4-11)2-3-9(5-12)10(7)6-13/h2-3H,1H3 |
| InChIKey | JIEVAEHRUKLDSY-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |