C18H6N4 — CID 176917652
3-[2-(2,3-dicyanophenyl)ethynyl]benzene-1,2-dicarbonitrile (PubChem CID 176917652) has the molecular formula C18H6N4 and a molecular weight of 278.27 g/mol. Its IUPAC name is 3-[2-(2,3-dicyanophenyl)ethynyl]benzene-1,2-dicarbonitrile.
| Compound Name | 3-[2-(2,3-dicyanophenyl)ethynyl]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 176917652 |
| Molecular Formula | C18H6N4 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 3-[2-(2,3-dicyanophenyl)ethynyl]benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1cccc(C#Cc2cccc(C#N)c2C#N)c1C#N |
| InChI | InChI=1S/C18H6N4/c19-9-15-5-1-3-13(17(15)11-21)7-8-14-4-2-6-16(10-20)18(14)12-22/h1-6H |
| InChIKey | IDHOGJDQZZQORT-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|