About 4-cyano-2,3-dimethylbenzenesulfonic acid
4-cyano-2,3-dimethylbenzenesulfonic acid (PubChem CID 171775492) has the molecular formula C9H9NO3S
and a molecular weight of 211.24 g/mol. Its IUPAC name is 4-cyano-2,3-dimethylbenzenesulfonic acid.
Molecular Properties
| Compound Name | 4-cyano-2,3-dimethylbenzenesulfonic acid |
| PubChem CID | 171775492 |
| Molecular Formula | C9H9NO3S |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.03 |
| IUPAC Name | 4-cyano-2,3-dimethylbenzenesulfonic acid |
| SMILES | Cc1c(C#N)ccc(S(=O)(=O)O)c1C |
| InChI | InChI=1S/C9H9NO3S/c1-6-7(2)9(14(11,12)13)4-3-8(6)5-10/h3-4H,1-2H3,(H,11,12,13) |
| InChIKey | VLEBBAOIAIVXOR-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-cyano-2,3-dimethylbenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyano-2,3-dimethylbenzenesulfonic acid?
The IUPAC name of 4-cyano-2,3-dimethylbenzenesulfonic acid (CID 171775492) is 4-cyano-2,3-dimethylbenzenesulfonic acid.
What is the SMILES notation for 4-cyano-2,3-dimethylbenzenesulfonic acid?
The canonical SMILES for 4-cyano-2,3-dimethylbenzenesulfonic acid is Cc1c(C#N)ccc(S(=O)(=O)O)c1C.
What is the InChIKey of 4-cyano-2,3-dimethylbenzenesulfonic acid?
The InChIKey is VLEBBAOIAIVXOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO3S/c1-6-7(2)9(14(11,12)13)4-3-8(6)5-10/h3-4H,1-2H3,(H,11,12,13).
What are the key properties of 4-cyano-2,3-dimethylbenzenesulfonic acid?
4-cyano-2,3-dimethylbenzenesulfonic acid has a molecular weight of 211.24 g/mol, XLogP of 1.42, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyano-2,3-dimethylbenzenesulfonic acid is sourced from PubChem (CID 171775492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).