4-cyano-2,3-dimethylbenzenesulfonic acid

C9H9NO3S — CID 171775492

IUPAC4-cyano-2,3-dimethylbenzenesulfonic acid
SMILESCc1c(C#N)ccc(S(=O)(=O)O)c1C
InChIInChI=1S/C9H9NO3S/c1-6-7(2)9(14(11,12)13)4-3-8(6)5-10/h3-4H,1-2H3,(H,11,12,13)
InChIKeyVLEBBAOIAIVXOR-UHFFFAOYSA-N
MW211.24 g/mol
LogP1.42
Rot. Bonds1

About 4-cyano-2,3-dimethylbenzenesulfonic acid

4-cyano-2,3-dimethylbenzenesulfonic acid (PubChem CID 171775492) has the molecular formula C9H9NO3S and a molecular weight of 211.24 g/mol. Its IUPAC name is 4-cyano-2,3-dimethylbenzenesulfonic acid.

Molecular Properties

Compound Name4-cyano-2,3-dimethylbenzenesulfonic acid
PubChem CID171775492
Molecular FormulaC9H9NO3S
Molecular Weight211.24 g/mol
Exact Mass211.03
IUPAC Name4-cyano-2,3-dimethylbenzenesulfonic acid
SMILESCc1c(C#N)ccc(S(=O)(=O)O)c1C
InChIInChI=1S/C9H9NO3S/c1-6-7(2)9(14(11,12)13)4-3-8(6)5-10/h3-4H,1-2H3,(H,11,12,13)
InChIKeyVLEBBAOIAIVXOR-UHFFFAOYSA-N
XLogP1.42
TPSA78.16 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500211.24
LogP ≤ 51.42
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 4-cyano-2,3-dimethylbenzenesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-cyano-2,3-dimethylbenzenesulfonic acid?
The IUPAC name of 4-cyano-2,3-dimethylbenzenesulfonic acid (CID 171775492) is 4-cyano-2,3-dimethylbenzenesulfonic acid.
What is the SMILES notation for 4-cyano-2,3-dimethylbenzenesulfonic acid?
The canonical SMILES for 4-cyano-2,3-dimethylbenzenesulfonic acid is Cc1c(C#N)ccc(S(=O)(=O)O)c1C.
What is the InChIKey of 4-cyano-2,3-dimethylbenzenesulfonic acid?
The InChIKey is VLEBBAOIAIVXOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO3S/c1-6-7(2)9(14(11,12)13)4-3-8(6)5-10/h3-4H,1-2H3,(H,11,12,13).
What are the key properties of 4-cyano-2,3-dimethylbenzenesulfonic acid?
4-cyano-2,3-dimethylbenzenesulfonic acid has a molecular weight of 211.24 g/mol, XLogP of 1.42, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyano-2,3-dimethylbenzenesulfonic acid is sourced from PubChem (CID 171775492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).