C8H5F2NO2S — CID 117308866
2,3-difluoro-4-methylsulfonylbenzonitrile (PubChem CID 117308866) has the molecular formula C8H5F2NO2S and a molecular weight of 217.20 g/mol. Its IUPAC name is 2,3-difluoro-4-methylsulfonylbenzonitrile.
| Compound Name | 2,3-difluoro-4-methylsulfonylbenzonitrile |
|---|---|
| PubChem CID | 117308866 |
| Molecular Formula | C8H5F2NO2S |
| Molecular Weight | 217.20 g/mol |
| Exact Mass | 217.00 |
| IUPAC Name | 2,3-difluoro-4-methylsulfonylbenzonitrile |
| SMILES | CS(=O)(=O)c1ccc(C#N)c(F)c1F |
| InChI | InChI=1S/C8H5F2NO2S/c1-14(12,13)6-3-2-5(4-11)7(9)8(6)10/h2-3H,1H3 |
| InChIKey | DUJCVUUUPGNSRZ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.20 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |