C8H9F2NO2S — CID 117315311
(2,3-difluoro-4-methylsulfonylphenyl)methanamine (PubChem CID 117315311) has the molecular formula C8H9F2NO2S and a molecular weight of 221.23 g/mol. Its IUPAC name is (2,3-difluoro-4-methylsulfonylphenyl)methanamine.
| Compound Name | (2,3-difluoro-4-methylsulfonylphenyl)methanamine |
|---|---|
| PubChem CID | 117315311 |
| Molecular Formula | C8H9F2NO2S |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.03 |
| IUPAC Name | (2,3-difluoro-4-methylsulfonylphenyl)methanamine |
| SMILES | CS(=O)(=O)c1ccc(CN)c(F)c1F |
| InChI | InChI=1S/C8H9F2NO2S/c1-14(12,13)6-3-2-5(4-11)7(9)8(6)10/h2-3H,4,11H2,1H3 |
| InChIKey | LBHHCVVYVDTONC-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |