C9H13NO4S2 — CID 117412708
[2,3-bis(methylsulfonyl)phenyl]methanamine (PubChem CID 117412708) has the molecular formula C9H13NO4S2 and a molecular weight of 263.34 g/mol. Its IUPAC name is [2,3-bis(methylsulfonyl)phenyl]methanamine.
| Compound Name | [2,3-bis(methylsulfonyl)phenyl]methanamine |
|---|---|
| PubChem CID | 117412708 |
| Molecular Formula | C9H13NO4S2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | [2,3-bis(methylsulfonyl)phenyl]methanamine |
| SMILES | CS(=O)(=O)c1cccc(CN)c1S(C)(=O)=O |
| InChI | InChI=1S/C9H13NO4S2/c1-15(11,12)8-5-3-4-7(6-10)9(8)16(2,13)14/h3-5H,6,10H2,1-2H3 |
| InChIKey | BZIFLDNPLRGMBY-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |