C9H8F3IO2S — CID 167140925
2-iodo-1-methylsulfonyl-3-(2,2,2-trifluoroethyl)benzene (PubChem CID 167140925) has the molecular formula C9H8F3IO2S and a molecular weight of 364.13 g/mol. Its IUPAC name is 2-iodo-1-methylsulfonyl-3-(2,2,2-trifluoroethyl)benzene.
| Compound Name | 2-iodo-1-methylsulfonyl-3-(2,2,2-trifluoroethyl)benzene |
|---|---|
| PubChem CID | 167140925 |
| Molecular Formula | C9H8F3IO2S |
| Molecular Weight | 364.13 g/mol |
| Exact Mass | 363.92 |
| IUPAC Name | 2-iodo-1-methylsulfonyl-3-(2,2,2-trifluoroethyl)benzene |
| SMILES | CS(=O)(=O)c1cccc(CC(F)(F)F)c1I |
| InChI | InChI=1S/C9H8F3IO2S/c1-16(14,15)7-4-2-3-6(8(7)13)5-9(10,11)12/h2-4H,5H2,1H3 |
| InChIKey | LFUAXRDFKAVEEU-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.13 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|