C9H15ClN2O2S — CID 69446496
[3-(aminomethyl)-2-methylphenyl]methanesulfonamide;hydrochloride (PubChem CID 69446496) has the molecular formula C9H15ClN2O2S and a molecular weight of 250.75 g/mol. Its IUPAC name is [3-(aminomethyl)-2-methylphenyl]methanesulfonamide;hydrochloride.
| Compound Name | [3-(aminomethyl)-2-methylphenyl]methanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 69446496 |
| Molecular Formula | C9H15ClN2O2S |
| Molecular Weight | 250.75 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | [3-(aminomethyl)-2-methylphenyl]methanesulfonamide;hydrochloride |
| SMILES | Cc1c(CN)cccc1CS(N)(=O)=O.Cl |
| InChI | InChI=1S/C9H14N2O2S.ClH/c1-7-8(5-10)3-2-4-9(7)6-14(11,12)13;/h2-4H,5-6,10H2,1H3,(H2,11,12,13);1H |
| InChIKey | ACTQTGIRQGEUBM-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.75 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |