C8H12N2O4S2 — CID 170547357
[2-(methanesulfonamido)phenyl]methanesulfonamide (PubChem CID 170547357) has the molecular formula C8H12N2O4S2 and a molecular weight of 264.33 g/mol. Its IUPAC name is [2-(methanesulfonamido)phenyl]methanesulfonamide.
| Compound Name | [2-(methanesulfonamido)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 170547357 |
| Molecular Formula | C8H12N2O4S2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.02 |
| IUPAC Name | [2-(methanesulfonamido)phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccccc1CS(N)(=O)=O |
| InChI | InChI=1S/C8H12N2O4S2/c1-15(11,12)10-8-5-3-2-4-7(8)6-16(9,13)14/h2-5,10H,6H2,1H3,(H2,9,13,14) |
| InChIKey | CNPVTGYOXQVAMO-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |