C12H20N2O2S — CID 61324135
N-[2-(2,2-dimethylpropylamino)phenyl]methanesulfonamide (PubChem CID 61324135) has the molecular formula C12H20N2O2S and a molecular weight of 256.37 g/mol. Its IUPAC name is N-[2-(2,2-dimethylpropylamino)phenyl]methanesulfonamide.
| Compound Name | N-[2-(2,2-dimethylpropylamino)phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 61324135 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | N-[2-(2,2-dimethylpropylamino)phenyl]methanesulfonamide |
| SMILES | CC(C)(C)CNc1ccccc1NS(C)(=O)=O |
| InChI | InChI=1S/C12H20N2O2S/c1-12(2,3)9-13-10-7-5-6-8-11(10)14-17(4,15)16/h5-8,13-14H,9H2,1-4H3 |
| InChIKey | TWZXTLNFJPFJSN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |