C15H25N — CID 63426950
2-tert-butyl-N-(2,2-dimethylpropyl)aniline (PubChem CID 63426950) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is 2-tert-butyl-N-(2,2-dimethylpropyl)aniline.
| Compound Name | 2-tert-butyl-N-(2,2-dimethylpropyl)aniline |
|---|---|
| PubChem CID | 63426950 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 2-tert-butyl-N-(2,2-dimethylpropyl)aniline |
| SMILES | CC(C)(C)CNc1ccccc1C(C)(C)C |
| InChI | InChI=1S/C15H25N/c1-14(2,3)11-16-13-10-8-7-9-12(13)15(4,5)6/h7-10,16H,11H2,1-6H3 |
| InChIKey | OMFRLOCIWXUPKW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |