C12H13ClN2O2S2 — CID 43743995
N-[2-[(5-chlorothiophen-2-yl)methylamino]phenyl]methanesulfonamide (PubChem CID 43743995) has the molecular formula C12H13ClN2O2S2 and a molecular weight of 316.84 g/mol. Its IUPAC name is N-[2-[(5-chlorothiophen-2-yl)methylamino]phenyl]methanesulfonamide.
| Compound Name | N-[2-[(5-chlorothiophen-2-yl)methylamino]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 43743995 |
| Molecular Formula | C12H13ClN2O2S2 |
| Molecular Weight | 316.84 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | N-[2-[(5-chlorothiophen-2-yl)methylamino]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccccc1NCc1ccc(Cl)s1 |
| InChI | InChI=1S/C12H13ClN2O2S2/c1-19(16,17)15-11-5-3-2-4-10(11)14-8-9-6-7-12(13)18-9/h2-7,14-15H,8H2,1H3 |
| InChIKey | LBPNCLRJRFIFRN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.84 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |