C13H14ClNOS — CID 43741643
3-[(5-chlorothiophen-2-yl)methylamino]-2,6-dimethylphenol (PubChem CID 43741643) has the molecular formula C13H14ClNOS and a molecular weight of 267.78 g/mol. Its IUPAC name is 3-[(5-chlorothiophen-2-yl)methylamino]-2,6-dimethylphenol.
| Compound Name | 3-[(5-chlorothiophen-2-yl)methylamino]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 43741643 |
| Molecular Formula | C13H14ClNOS |
| Molecular Weight | 267.78 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 3-[(5-chlorothiophen-2-yl)methylamino]-2,6-dimethylphenol |
| SMILES | Cc1ccc(NCc2ccc(Cl)s2)c(C)c1O |
| InChI | InChI=1S/C13H14ClNOS/c1-8-3-5-11(9(2)13(8)16)15-7-10-4-6-12(14)17-10/h3-6,15-16H,7H2,1-2H3 |
| InChIKey | ZKSJVPNWOBPFAR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.78 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |