C15H17NO2 — CID 43741748
3-[(2-hydroxyphenyl)methylamino]-2,6-dimethylphenol (PubChem CID 43741748) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is 3-[(2-hydroxyphenyl)methylamino]-2,6-dimethylphenol.
| Compound Name | 3-[(2-hydroxyphenyl)methylamino]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 43741748 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 3-[(2-hydroxyphenyl)methylamino]-2,6-dimethylphenol |
| SMILES | Cc1ccc(NCc2ccccc2O)c(C)c1O |
| InChI | InChI=1S/C15H17NO2/c1-10-7-8-13(11(2)15(10)18)16-9-12-5-3-4-6-14(12)17/h3-8,16-18H,9H2,1-2H3 |
| InChIKey | UWTQHHXXELZIAN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|