C17H21NO — CID 43741705
3-[(4-ethylphenyl)methylamino]-2,6-dimethylphenol (PubChem CID 43741705) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is 3-[(4-ethylphenyl)methylamino]-2,6-dimethylphenol.
| Compound Name | 3-[(4-ethylphenyl)methylamino]-2,6-dimethylphenol |
|---|---|
| PubChem CID | 43741705 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 3-[(4-ethylphenyl)methylamino]-2,6-dimethylphenol |
| SMILES | CCc1ccc(CNc2ccc(C)c(O)c2C)cc1 |
| InChI | InChI=1S/C17H21NO/c1-4-14-6-8-15(9-7-14)11-18-16-10-5-12(2)17(19)13(16)3/h5-10,18-19H,4,11H2,1-3H3 |
| InChIKey | JWBKUWIQVCYYEN-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |