C13H15NO2 — CID 63204508
3-(furan-3-ylmethylamino)-2,6-dimethylphenol (PubChem CID 63204508) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is 3-(furan-3-ylmethylamino)-2,6-dimethylphenol.
| Compound Name | 3-(furan-3-ylmethylamino)-2,6-dimethylphenol |
|---|---|
| PubChem CID | 63204508 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 3-(furan-3-ylmethylamino)-2,6-dimethylphenol |
| SMILES | Cc1ccc(NCc2ccoc2)c(C)c1O |
| InChI | InChI=1S/C13H15NO2/c1-9-3-4-12(10(2)13(9)15)14-7-11-5-6-16-8-11/h3-6,8,14-15H,7H2,1-2H3 |
| InChIKey | SDTLQXIJANQYII-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |