About 3-(furan-3-ylmethylamino)-2,6-dimethylphenol
3-(furan-3-ylmethylamino)-2,6-dimethylphenol (PubChem CID 63204508) has the molecular formula C13H15NO2
and a molecular weight of 217.27 g/mol. Its IUPAC name is 3-(furan-3-ylmethylamino)-2,6-dimethylphenol.
Molecular Properties
| Compound Name | 3-(furan-3-ylmethylamino)-2,6-dimethylphenol |
| PubChem CID | 63204508 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 3-(furan-3-ylmethylamino)-2,6-dimethylphenol |
| SMILES | Cc1ccc(NCc2ccoc2)c(C)c1O |
| InChI | InChI=1S/C13H15NO2/c1-9-3-4-12(10(2)13(9)15)14-7-11-5-6-16-8-11/h3-6,8,14-15H,7H2,1-2H3 |
| InChIKey | SDTLQXIJANQYII-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(furan-3-ylmethylamino)-2,6-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(furan-3-ylmethylamino)-2,6-dimethylphenol?
The IUPAC name of 3-(furan-3-ylmethylamino)-2,6-dimethylphenol (CID 63204508) is 3-(furan-3-ylmethylamino)-2,6-dimethylphenol.
What is the SMILES notation for 3-(furan-3-ylmethylamino)-2,6-dimethylphenol?
The canonical SMILES for 3-(furan-3-ylmethylamino)-2,6-dimethylphenol is Cc1ccc(NCc2ccoc2)c(C)c1O.
What is the InChIKey of 3-(furan-3-ylmethylamino)-2,6-dimethylphenol?
The InChIKey is SDTLQXIJANQYII-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO2/c1-9-3-4-12(10(2)13(9)15)14-7-11-5-6-16-8-11/h3-6,8,14-15H,7H2,1-2H3.
What are the key properties of 3-(furan-3-ylmethylamino)-2,6-dimethylphenol?
3-(furan-3-ylmethylamino)-2,6-dimethylphenol has a molecular weight of 217.27 g/mol, XLogP of 3.21, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(furan-3-ylmethylamino)-2,6-dimethylphenol is sourced from PubChem (CID 63204508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).