C13H15NO — CID 115749450
N-(furan-3-ylmethyl)-2,6-dimethylaniline (PubChem CID 115749450) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is N-(furan-3-ylmethyl)-2,6-dimethylaniline.
| Compound Name | N-(furan-3-ylmethyl)-2,6-dimethylaniline |
|---|---|
| PubChem CID | 115749450 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | N-(furan-3-ylmethyl)-2,6-dimethylaniline |
| SMILES | Cc1cccc(C)c1NCc1ccoc1 |
| InChI | InChI=1S/C13H15NO/c1-10-4-3-5-11(2)13(10)14-8-12-6-7-15-9-12/h3-7,9,14H,8H2,1-2H3 |
| InChIKey | MISSTYJIZUTESJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |