C17H20N2O — CID 80650501
3-(2,3-dihydro-1H-indol-7-ylmethylamino)-2,6-dimethylphenol (PubChem CID 80650501) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-indol-7-ylmethylamino)-2,6-dimethylphenol.
| Compound Name | 3-(2,3-dihydro-1H-indol-7-ylmethylamino)-2,6-dimethylphenol |
|---|---|
| PubChem CID | 80650501 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 3-(2,3-dihydro-1H-indol-7-ylmethylamino)-2,6-dimethylphenol |
| SMILES | Cc1ccc(NCc2cccc3c2NCC3)c(C)c1O |
| InChI | InChI=1S/C17H20N2O/c1-11-6-7-15(12(2)17(11)20)19-10-14-5-3-4-13-8-9-18-16(13)14/h3-7,18-20H,8-10H2,1-2H3 |
| InChIKey | AXRIXBOXGPXGJI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |