C15H15BrN2 — CID 80650469
3-bromo-N-(2,3-dihydro-1H-indol-7-ylmethyl)aniline (PubChem CID 80650469) has the molecular formula C15H15BrN2 and a molecular weight of 303.20 g/mol. Its IUPAC name is 3-bromo-N-(2,3-dihydro-1H-indol-7-ylmethyl)aniline.
| Compound Name | 3-bromo-N-(2,3-dihydro-1H-indol-7-ylmethyl)aniline |
|---|---|
| PubChem CID | 80650469 |
| Molecular Formula | C15H15BrN2 |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 3-bromo-N-(2,3-dihydro-1H-indol-7-ylmethyl)aniline |
| SMILES | Brc1cccc(NCc2cccc3c2NCC3)c1 |
| InChI | InChI=1S/C15H15BrN2/c16-13-5-2-6-14(9-13)18-10-12-4-1-3-11-7-8-17-15(11)12/h1-6,9,17-18H,7-8,10H2 |
| InChIKey | WNPUBQVNKRLEDC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |