C14H14FN3 — CID 114254338
N-(2,3-dihydro-1H-indol-7-ylmethyl)-5-fluoropyridin-3-amine (PubChem CID 114254338) has the molecular formula C14H14FN3 and a molecular weight of 243.29 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-indol-7-ylmethyl)-5-fluoropyridin-3-amine.
| Compound Name | N-(2,3-dihydro-1H-indol-7-ylmethyl)-5-fluoropyridin-3-amine |
|---|---|
| PubChem CID | 114254338 |
| Molecular Formula | C14H14FN3 |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | N-(2,3-dihydro-1H-indol-7-ylmethyl)-5-fluoropyridin-3-amine |
| SMILES | Fc1cncc(NCc2cccc3c2NCC3)c1 |
| InChI | InChI=1S/C14H14FN3/c15-12-6-13(9-16-8-12)18-7-11-3-1-2-10-4-5-17-14(10)11/h1-3,6,8-9,17-18H,4-5,7H2 |
| InChIKey | FJOBALCESUDQLI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |