C16H16N4 — CID 80648541
N-(2,3-dihydro-1H-indol-7-ylmethyl)-1H-indazol-5-amine (PubChem CID 80648541) has the molecular formula C16H16N4 and a molecular weight of 264.33 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-indol-7-ylmethyl)-1H-indazol-5-amine.
| Compound Name | N-(2,3-dihydro-1H-indol-7-ylmethyl)-1H-indazol-5-amine |
|---|---|
| PubChem CID | 80648541 |
| Molecular Formula | C16H16N4 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | N-(2,3-dihydro-1H-indol-7-ylmethyl)-1H-indazol-5-amine |
| SMILES | c1cc2c(c(CNc3ccc4[nH]ncc4c3)c1)NCC2 |
| InChI | InChI=1S/C16H16N4/c1-2-11-6-7-17-16(11)12(3-1)9-18-14-4-5-15-13(8-14)10-19-20-15/h1-5,8,10,17-18H,6-7,9H2,(H,19,20) |
| InChIKey | KDRLKJCGBOHTMJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |